Organic acids and derivatives
Filtered Search Results
Ethyl thiophene-3-carboxylate, 98%
CAS: 5751-80-4 Molecular Formula: C7H8O2S Molecular Weight (g/mol): 156.199 MDL Number: MFCD02179226 InChI Key: OYSLMAQEMAJMCL-UHFFFAOYSA-N Synonym: ethyl 3-thenoate,ethyl 3-thiophenecarboxylate,ethylthiophene-3-carboxylate,3-ethoxycarbonyl thiophene,3-thiophenecarboxylic acid ethyl ester,3-thiophenecarboxylic acid, ethyl ester,thiophene-3-carboxylic acid ethyl ester,pubchem16116,ksc493o3n PubChem CID: 79824 IUPAC Name: ethyl thiophene-3-carboxylate SMILES: CCOC(=O)C1=CSC=C1
| PubChem CID | 79824 |
|---|---|
| CAS | 5751-80-4 |
| Molecular Weight (g/mol) | 156.199 |
| MDL Number | MFCD02179226 |
| SMILES | CCOC(=O)C1=CSC=C1 |
| Synonym | ethyl 3-thenoate,ethyl 3-thiophenecarboxylate,ethylthiophene-3-carboxylate,3-ethoxycarbonyl thiophene,3-thiophenecarboxylic acid ethyl ester,3-thiophenecarboxylic acid, ethyl ester,thiophene-3-carboxylic acid ethyl ester,pubchem16116,ksc493o3n |
| IUPAC Name | ethyl thiophene-3-carboxylate |
| InChI Key | OYSLMAQEMAJMCL-UHFFFAOYSA-N |
| Molecular Formula | C7H8O2S |
| MDL Number | MFCD00002762 |
|---|
n-Butyl butyrate, 99%
CAS: 109-21-7 Molecular Formula: C8H16O2 Molecular Weight (g/mol): 144.21 MDL Number: MFCD00009450 InChI Key: XUPYJHCZDLZNFP-UHFFFAOYSA-N Synonym: butyl butyrate,n-butyl butyrate,butanoic acid, butyl ester,n-butyl butanoate,1-butyl butyrate,butyl butylate,butyric acid butyl ester,n-butyl n-butyrate,butyric acid, butyl ester,butyl n-butyrate PubChem CID: 7983 ChEBI: CHEBI:87429 IUPAC Name: butyl butanoate SMILES: CCCCOC(=O)CCC
| PubChem CID | 7983 |
|---|---|
| CAS | 109-21-7 |
| Molecular Weight (g/mol) | 144.21 |
| ChEBI | CHEBI:87429 |
| MDL Number | MFCD00009450 |
| SMILES | CCCCOC(=O)CCC |
| Synonym | butyl butyrate,n-butyl butyrate,butanoic acid, butyl ester,n-butyl butanoate,1-butyl butyrate,butyl butylate,butyric acid butyl ester,n-butyl n-butyrate,butyric acid, butyl ester,butyl n-butyrate |
| IUPAC Name | butyl butanoate |
| InChI Key | XUPYJHCZDLZNFP-UHFFFAOYSA-N |
| Molecular Formula | C8H16O2 |
4-Biphenylacetic acid, 98%
CAS: 5728-52-9 MDL Number: MFCD00004351 InChI Key: QRZAKQDHEVVFRX-UHFFFAOYSA-N Synonym: 4-biphenylacetic acid,felbinac,4-biphenylylacetic acid,traxam,dolinac,4-carboxymethylbiphenyl,napageln,2-4-phenylphenyl acetic acid,p-biphenylylacetic acid,1,1'-biphenyl-4-acetic acid PubChem CID: 3332 ChEBI: CHEBI:31597 IUPAC Name: 2-(4-phenylphenyl)acetic acid SMILES: C1=CC=C(C=C1)C2=CC=C(C=C2)CC(=O)O
| PubChem CID | 3332 |
|---|---|
| CAS | 5728-52-9 |
| ChEBI | CHEBI:31597 |
| MDL Number | MFCD00004351 |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CC(=O)O |
| Synonym | 4-biphenylacetic acid,felbinac,4-biphenylylacetic acid,traxam,dolinac,4-carboxymethylbiphenyl,napageln,2-4-phenylphenyl acetic acid,p-biphenylylacetic acid,1,1'-biphenyl-4-acetic acid |
| IUPAC Name | 2-(4-phenylphenyl)acetic acid |
| InChI Key | QRZAKQDHEVVFRX-UHFFFAOYSA-N |
Allyl acetate, 98%
CAS: 591-87-7 MDL Number: MFCD00008721 InChI Key: FWZUNOYOVVKUNF-UHFFFAOYSA-N Synonym: allyl acetate,3-acetoxypropene,acetic acid, 2-propenyl ester,2-propenyl acetate,2-propenyl ethanoate,3-acetoxy-1-propene,allylacetate,acetic acid, allyl ester,2-propenyl methanoate,unii-e4u5e5990i PubChem CID: 11584 IUPAC Name: prop-2-enyl acetate SMILES: CC(=O)OCC=C
| PubChem CID | 11584 |
|---|---|
| CAS | 591-87-7 |
| MDL Number | MFCD00008721 |
| SMILES | CC(=O)OCC=C |
| Synonym | allyl acetate,3-acetoxypropene,acetic acid, 2-propenyl ester,2-propenyl acetate,2-propenyl ethanoate,3-acetoxy-1-propene,allylacetate,acetic acid, allyl ester,2-propenyl methanoate,unii-e4u5e5990i |
| IUPAC Name | prop-2-enyl acetate |
| InChI Key | FWZUNOYOVVKUNF-UHFFFAOYSA-N |
Gallic acid ethyl ester, 99%
CAS: 831-61-8 Molecular Formula: C9H10O5 Molecular Weight (g/mol): 198.174 MDL Number: MFCD00016430 InChI Key: VFPFQHQNJCMNBZ-UHFFFAOYSA-N Synonym: ethyl gallate,gallic acid ethyl ester,phyllemblin,nipagallin a,progallin a,ethylgallate,nipa no. 48,gallic acid, ethyl ester,benzoic acid, 3,4,5-trihydroxy-, ethyl ester,nipa 48 PubChem CID: 13250 ChEBI: CHEBI:87247 IUPAC Name: ethyl 3,4,5-trihydroxybenzoate SMILES: CCOC(=O)C1=CC(=C(C(=C1)O)O)O
| PubChem CID | 13250 |
|---|---|
| CAS | 831-61-8 |
| Molecular Weight (g/mol) | 198.174 |
| ChEBI | CHEBI:87247 |
| MDL Number | MFCD00016430 |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)O)O)O |
| Synonym | ethyl gallate,gallic acid ethyl ester,phyllemblin,nipagallin a,progallin a,ethylgallate,nipa no. 48,gallic acid, ethyl ester,benzoic acid, 3,4,5-trihydroxy-, ethyl ester,nipa 48 |
| IUPAC Name | ethyl 3,4,5-trihydroxybenzoate |
| InChI Key | VFPFQHQNJCMNBZ-UHFFFAOYSA-N |
| Molecular Formula | C9H10O5 |
3-(4-Carboxyphenyl)propionic acid, 98%
CAS: 38628-51-2 Molecular Formula: C10H10O4 Molecular Weight (g/mol): 194.19 MDL Number: MFCD00016560 InChI Key: QSPCOYVUYYFWAU-UHFFFAOYSA-N Synonym: 4-2-carboxyethyl benzoic acid,3-4-carboxyphenyl propionic acid,3-4-carboxyphenyl propanoic acid,benzenepropanoic acid, 4-carboxy,pubchem19268,acmc-1ctf7,4-carboxyhydrocinnamic acid,4-carboxybenzenepropionic acid,4-2-carboxyethyl benzoicacid,carboxyphenylpropionicacid; 985 PubChem CID: 854054 IUPAC Name: 4-(2-carboxyethyl)benzoic acid SMILES: OC(=O)CCC1=CC=C(C=C1)C(O)=O
| PubChem CID | 854054 |
|---|---|
| CAS | 38628-51-2 |
| Molecular Weight (g/mol) | 194.19 |
| MDL Number | MFCD00016560 |
| SMILES | OC(=O)CCC1=CC=C(C=C1)C(O)=O |
| Synonym | 4-2-carboxyethyl benzoic acid,3-4-carboxyphenyl propionic acid,3-4-carboxyphenyl propanoic acid,benzenepropanoic acid, 4-carboxy,pubchem19268,acmc-1ctf7,4-carboxyhydrocinnamic acid,4-carboxybenzenepropionic acid,4-2-carboxyethyl benzoicacid,carboxyphenylpropionicacid; 985 |
| IUPAC Name | 4-(2-carboxyethyl)benzoic acid |
| InChI Key | QSPCOYVUYYFWAU-UHFFFAOYSA-N |
| Molecular Formula | C10H10O4 |
Ammonium formate, 97%
CAS: 540-69-2 Molecular Formula: CH5NO2 Molecular Weight (g/mol): 63.056 MDL Number: MFCD00013103 InChI Key: VZTDIZULWFCMLS-UHFFFAOYSA-N Synonym: ammonium formate,formic acid, ammonium salt,formic acid ammonium salt,ammoniumformate,azanium formate,ammonium formiate,formic acid, ammonium salt 1:1,mravencan amonny czech,hsdb 479,mravencan amonny PubChem CID: 2723923 ChEBI: CHEBI:63050 IUPAC Name: azanium;formate SMILES: C(=O)[O-].[NH4+]
| PubChem CID | 2723923 |
|---|---|
| CAS | 540-69-2 |
| Molecular Weight (g/mol) | 63.056 |
| ChEBI | CHEBI:63050 |
| MDL Number | MFCD00013103 |
| SMILES | C(=O)[O-].[NH4+] |
| Synonym | ammonium formate,formic acid, ammonium salt,formic acid ammonium salt,ammoniumformate,azanium formate,ammonium formiate,formic acid, ammonium salt 1:1,mravencan amonny czech,hsdb 479,mravencan amonny |
| IUPAC Name | azanium;formate |
| InChI Key | VZTDIZULWFCMLS-UHFFFAOYSA-N |
| Molecular Formula | CH5NO2 |
1-Benzothiophene-5-carboxylic acid, 97%, Thermo Scientific™
CAS: 2060-64-2 Molecular Formula: C9H6O2S Molecular Weight (g/mol): 178.21 MDL Number: MFCD04974042 InChI Key: SNBYTKLWZRHESA-UHFFFAOYSA-N Synonym: benzo b thiophene-5-carboxylic acid,buttpark 98\04-76,pubchem20599,5-carboxybenzo b thiophene,benzothiophene-5-carboxylic acid,benzo b thiophene-5-carboxylicacid,1-benzo b thiophene-5-carboxylic acid PubChem CID: 2795444 IUPAC Name: 1-benzothiophene-5-carboxylic acid SMILES: OC(=O)C1=CC=C2SC=CC2=C1
| PubChem CID | 2795444 |
|---|---|
| CAS | 2060-64-2 |
| Molecular Weight (g/mol) | 178.21 |
| MDL Number | MFCD04974042 |
| SMILES | OC(=O)C1=CC=C2SC=CC2=C1 |
| Synonym | benzo b thiophene-5-carboxylic acid,buttpark 98\04-76,pubchem20599,5-carboxybenzo b thiophene,benzothiophene-5-carboxylic acid,benzo b thiophene-5-carboxylicacid,1-benzo b thiophene-5-carboxylic acid |
| IUPAC Name | 1-benzothiophene-5-carboxylic acid |
| InChI Key | SNBYTKLWZRHESA-UHFFFAOYSA-N |
| Molecular Formula | C9H6O2S |
Ethyl pyrrole-2-carboxylate, 98+%
CAS: 2199-43-1 Molecular Formula: C7H9NO2 Molecular Weight (g/mol): 139.154 MDL Number: MFCD00817049 InChI Key: PAEYAKGINDQUCT-UHFFFAOYSA-N Synonym: ethyl pyrrole-2-carboxylate,ethyl 2-pyrrolecarboxylate,ethyl pyrrole-2-carbonate,ethylpyrrole-2-carboxylate,1h-pyrrole-2-carboxylic acid, ethyl ester,2-ethoxycarbonyl-1h-pyrrole,pyrrole-2-carboxylic acid, ethyl ester,1h-pyrrole-2-carboxylic acid ethyl ester,pyrrole-2-carboxylic acid ethyl ester,ethyl1h-pyrrole-2-carboxylate PubChem CID: 255670 IUPAC Name: ethyl 1H-pyrrole-2-carboxylate SMILES: CCOC(=O)C1=CC=CN1
| PubChem CID | 255670 |
|---|---|
| CAS | 2199-43-1 |
| Molecular Weight (g/mol) | 139.154 |
| MDL Number | MFCD00817049 |
| SMILES | CCOC(=O)C1=CC=CN1 |
| Synonym | ethyl pyrrole-2-carboxylate,ethyl 2-pyrrolecarboxylate,ethyl pyrrole-2-carbonate,ethylpyrrole-2-carboxylate,1h-pyrrole-2-carboxylic acid, ethyl ester,2-ethoxycarbonyl-1h-pyrrole,pyrrole-2-carboxylic acid, ethyl ester,1h-pyrrole-2-carboxylic acid ethyl ester,pyrrole-2-carboxylic acid ethyl ester,ethyl1h-pyrrole-2-carboxylate |
| IUPAC Name | ethyl 1H-pyrrole-2-carboxylate |
| InChI Key | PAEYAKGINDQUCT-UHFFFAOYSA-N |
| Molecular Formula | C7H9NO2 |
3-(tert-Butyl)-1-methyl-1H-pyrazole-carboxylic acid, 95%
CAS: 175277-11-9 Molecular Formula: C9H14N2O2 Molecular Weight (g/mol): 182.22 InChI Key: SFSXXMXHJOSBAZ-UHFFFAOYSA-N Synonym: 3-tert-butyl-1-methyl-1h-pyrazole-5-carboxylic acid,3-tert-butyl-1-methylpyrazole-5-carboxylic acid,5-tert-butyl-2-methyl-2h-pyrazole-3-carboxylic acid,1h-pyrazole-5-carboxylic acid, 3-1,1-dimethylethyl-1-methyl,3-t-butyl-1-methyl-1h-pyrazole-5-carboxylic acid,maybridge1_008671,acmc-1bzn5,butylmethylpyrazolecarboxylicacid PubChem CID: 720529 IUPAC Name: 5-tert-butyl-2-methylpyrazole-3-carboxylic acid SMILES: CC(C)(C)C1=NN(C(=C1)C(=O)O)C
| PubChem CID | 720529 |
|---|---|
| CAS | 175277-11-9 |
| Molecular Weight (g/mol) | 182.22 |
| SMILES | CC(C)(C)C1=NN(C(=C1)C(=O)O)C |
| Synonym | 3-tert-butyl-1-methyl-1h-pyrazole-5-carboxylic acid,3-tert-butyl-1-methylpyrazole-5-carboxylic acid,5-tert-butyl-2-methyl-2h-pyrazole-3-carboxylic acid,1h-pyrazole-5-carboxylic acid, 3-1,1-dimethylethyl-1-methyl,3-t-butyl-1-methyl-1h-pyrazole-5-carboxylic acid,maybridge1_008671,acmc-1bzn5,butylmethylpyrazolecarboxylicacid |
| IUPAC Name | 5-tert-butyl-2-methylpyrazole-3-carboxylic acid |
| InChI Key | SFSXXMXHJOSBAZ-UHFFFAOYSA-N |
| Molecular Formula | C9H14N2O2 |
n-Butyl Acetate, ACS, 99.5%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 123-86-4 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 InChI Key: DKPFZGUDAPQIHT-UHFFFAOYSA-N IUPAC Name: butyl acetate SMILES: CCCCOC(C)=O
| CAS | 123-86-4 |
|---|---|
| Molecular Weight (g/mol) | 116.16 |
| SMILES | CCCCOC(C)=O |
| IUPAC Name | butyl acetate |
| InChI Key | DKPFZGUDAPQIHT-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
2-Methylvaleric acid, 98+%
CAS: 97-61-0 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00002671 InChI Key: OVBFMEVBMNZIBR-UHFFFAOYSA-N Synonym: 2-methylvaleric acid,pentanoic acid, 2-methyl,valeric acid, 2-methyl,methylpropylacetic acid,2-pentanecarboxylic acid,2-methyl valeric acid,alpha-methylvaleric acid,pentanoic acid, methyl,kyselina 2-methylvalerova,fema no. 2754 PubChem CID: 7341 IUPAC Name: 2-methylpentanoic acid SMILES: CCCC(C)C(=O)O
| PubChem CID | 7341 |
|---|---|
| CAS | 97-61-0 |
| Molecular Weight (g/mol) | 116.16 |
| MDL Number | MFCD00002671 |
| SMILES | CCCC(C)C(=O)O |
| Synonym | 2-methylvaleric acid,pentanoic acid, 2-methyl,valeric acid, 2-methyl,methylpropylacetic acid,2-pentanecarboxylic acid,2-methyl valeric acid,alpha-methylvaleric acid,pentanoic acid, methyl,kyselina 2-methylvalerova,fema no. 2754 |
| IUPAC Name | 2-methylpentanoic acid |
| InChI Key | OVBFMEVBMNZIBR-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
Cobalt(II) acetate tetrahydrate, 98%
CAS: 6147-53-1 Molecular Formula: C4H14CoO8 MDL Number: MFCD00149569 InChI Key: ZBYYWKJVSFHYJL-UHFFFAOYSA-L Synonym: cobalt ii acetate tetrahydrate,cobalt acetate tetrahydrate,cobaltous acetate tetrahydrate,cobalt diacetate tetrahydrate,bis acetato tetraquacobalt,octan kobaltnaty czech,acetic acid, cobalt 2+ salt, tetrahydrate,octan kobaltnaty,ccris 9441 PubChem CID: 61372
| PubChem CID | 61372 |
|---|---|
| CAS | 6147-53-1 |
| MDL Number | MFCD00149569 |
| Synonym | cobalt ii acetate tetrahydrate,cobalt acetate tetrahydrate,cobaltous acetate tetrahydrate,cobalt diacetate tetrahydrate,bis acetato tetraquacobalt,octan kobaltnaty czech,acetic acid, cobalt 2+ salt, tetrahydrate,octan kobaltnaty,ccris 9441 |
| InChI Key | ZBYYWKJVSFHYJL-UHFFFAOYSA-L |
| Molecular Formula | C4H14CoO8 |
trans-Indole-3-acrylic acid, 98+%
CAS: 29953-71-7 Molecular Formula: C11H9NO2 Molecular Weight (g/mol): 187.198 MDL Number: MFCD00005633 InChI Key: PLVPPLCLBIEYEA-AATRIKPKSA-N Synonym: 3-indoleacrylic acid,trans-3-indoleacrylic acid,indole-3-acrylic acid,3-indolylacrylic acid,indole-3beta-acrylic acid,3-1h-indol-3-yl acrylic acid,indole-3-crylic acid,2e-3-1h-indol-3-yl prop-2-enoic acid,trans-3-1h-indol-3-yl acrylic acid,indoleacrylic acid van PubChem CID: 5375048 IUPAC Name: (E)-3-(1H-indol-3-yl)prop-2-enoic acid SMILES: C1=CC=C2C(=C1)C(=CN2)C=CC(=O)O
| PubChem CID | 5375048 |
|---|---|
| CAS | 29953-71-7 |
| Molecular Weight (g/mol) | 187.198 |
| MDL Number | MFCD00005633 |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C=CC(=O)O |
| Synonym | 3-indoleacrylic acid,trans-3-indoleacrylic acid,indole-3-acrylic acid,3-indolylacrylic acid,indole-3beta-acrylic acid,3-1h-indol-3-yl acrylic acid,indole-3-crylic acid,2e-3-1h-indol-3-yl prop-2-enoic acid,trans-3-1h-indol-3-yl acrylic acid,indoleacrylic acid van |
| IUPAC Name | (E)-3-(1H-indol-3-yl)prop-2-enoic acid |
| InChI Key | PLVPPLCLBIEYEA-AATRIKPKSA-N |
| Molecular Formula | C11H9NO2 |